C25H27NO2S — CID 177370389
N-[(E)-1,5-diphenylpent-4-enyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 177370389) has the molecular formula C25H27NO2S and a molecular weight of 405.56 g/mol. Its IUPAC name is N-[(E)-1,5-diphenylpent-4-enyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(E)-1,5-diphenylpent-4-enyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 177370389 |
| Molecular Formula | C25H27NO2S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-[(E)-1,5-diphenylpent-4-enyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C(CC/C=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO2S/c1-21-17-19-24(20-18-21)29(27,28)26(2)25(23-14-7-4-8-15-23)16-10-9-13-22-11-5-3-6-12-22/h3-9,11-15,17-20,25H,10,16H2,1-2H3/b13-9+ |
| InChIKey | RHQILAXENXYUHX-UKTHLTGXSA-N |
| XLogP | 5.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |