C18H23NO2S — CID 46210780
N,4-dimethyl-N-[1-(4-methylphenyl)propyl]benzenesulfonamide (PubChem CID 46210780) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is N,4-dimethyl-N-[1-(4-methylphenyl)propyl]benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-[1-(4-methylphenyl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46210780 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N,4-dimethyl-N-[1-(4-methylphenyl)propyl]benzenesulfonamide |
| SMILES | CCC(c1ccc(C)cc1)N(C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23NO2S/c1-5-18(16-10-6-14(2)7-11-16)19(4)22(20,21)17-12-8-15(3)9-13-17/h6-13,18H,5H2,1-4H3 |
| InChIKey | JKAFKRYRBAMGAC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |