C12H17NO4S2 — CID 22216999
2-[methyl-(4-methylphenyl)sulfonylamino]-4-sulfanylbutanoic acid (PubChem CID 22216999) has the molecular formula C12H17NO4S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[methyl-(4-methylphenyl)sulfonylamino]-4-sulfanylbutanoic acid.
| Compound Name | 2-[methyl-(4-methylphenyl)sulfonylamino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 22216999 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-[methyl-(4-methylphenyl)sulfonylamino]-4-sulfanylbutanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C(CCS)C(=O)O)cc1 |
| InChI | InChI=1S/C12H17NO4S2/c1-9-3-5-10(6-4-9)19(16,17)13(2)11(7-8-18)12(14)15/h3-6,11,18H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | XILAOENOOLCMMX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|