C13H16N2O6S — CID 162730134
(2S)-2-[methyl-(4-nitrophenyl)sulfonylamino]hex-5-enoic acid (PubChem CID 162730134) has the molecular formula C13H16N2O6S and a molecular weight of 328.35 g/mol. Its IUPAC name is (2S)-2-[methyl-(4-nitrophenyl)sulfonylamino]hex-5-enoic acid.
| Compound Name | (2S)-2-[methyl-(4-nitrophenyl)sulfonylamino]hex-5-enoic acid |
|---|---|
| PubChem CID | 162730134 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (2S)-2-[methyl-(4-nitrophenyl)sulfonylamino]hex-5-enoic acid |
| SMILES | C=CCC[C@@H](C(=O)O)N(C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H16N2O6S/c1-3-4-5-12(13(16)17)14(2)22(20,21)11-8-6-10(7-9-11)15(18)19/h3,6-9,12H,1,4-5H2,2H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | QZALHNPNKSPYIT-LBPRGKRZSA-N |
| XLogP | 1.63 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|