C14H20N2O6S — CID 16732198
(3S)-5-methyl-3-[methyl-(4-nitrophenyl)sulfonylamino]hexanoic acid (PubChem CID 16732198) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is (3S)-5-methyl-3-[methyl-(4-nitrophenyl)sulfonylamino]hexanoic acid.
| Compound Name | (3S)-5-methyl-3-[methyl-(4-nitrophenyl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 16732198 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (3S)-5-methyl-3-[methyl-(4-nitrophenyl)sulfonylamino]hexanoic acid |
| SMILES | CC(C)C[C@@H](CC(=O)O)N(C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20N2O6S/c1-10(2)8-12(9-14(17)18)15(3)23(21,22)13-6-4-11(5-7-13)16(19)20/h4-7,10,12H,8-9H2,1-3H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | GDBFIKKVJPVRDE-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|