C30H27N3O7S — CID 16664543
(2S)-2-[methyl-(4-nitrophenyl)sulfonylamino]-4-oxo-4-(tritylamino)butanoic acid (PubChem CID 16664543) has the molecular formula C30H27N3O7S and a molecular weight of 573.63 g/mol. Its IUPAC name is (2S)-2-[methyl-(4-nitrophenyl)sulfonylamino]-4-oxo-4-(tritylamino)butanoic acid.
| Compound Name | (2S)-2-[methyl-(4-nitrophenyl)sulfonylamino]-4-oxo-4-(tritylamino)butanoic acid |
|---|---|
| PubChem CID | 16664543 |
| Molecular Formula | C30H27N3O7S |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | (2S)-2-[methyl-(4-nitrophenyl)sulfonylamino]-4-oxo-4-(tritylamino)butanoic acid |
| SMILES | CN([C@@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H27N3O7S/c1-32(41(39,40)26-19-17-25(18-20-26)33(37)38)27(29(35)36)21-28(34)31-30(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-20,27H,21H2,1H3,(H,31,34)(H,35,36)/t27-/m0/s1 |
| InChIKey | PEGSPYLZVGBOII-MHZLTWQESA-N |
| XLogP | 4.17 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|