C15H22N2O6S — CID 16732339
methyl (3R,4R)-4-methyl-3-[methyl-(4-nitrophenyl)sulfonylamino]hexanoate (PubChem CID 16732339) has the molecular formula C15H22N2O6S and a molecular weight of 358.42 g/mol. Its IUPAC name is methyl (3R,4R)-4-methyl-3-[methyl-(4-nitrophenyl)sulfonylamino]hexanoate.
| Compound Name | methyl (3R,4R)-4-methyl-3-[methyl-(4-nitrophenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 16732339 |
| Molecular Formula | C15H22N2O6S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | methyl (3R,4R)-4-methyl-3-[methyl-(4-nitrophenyl)sulfonylamino]hexanoate |
| SMILES | CC[C@@H](C)[C@@H](CC(=O)OC)N(C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H22N2O6S/c1-5-11(2)14(10-15(18)23-4)16(3)24(21,22)13-8-6-12(7-9-13)17(19)20/h6-9,11,14H,5,10H2,1-4H3/t11-,14-/m1/s1 |
| InChIKey | FRMVXGNZNVXSGI-BXUZGUMPSA-N |
| XLogP | 2.19 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|