C14H18N2O9S — CID 21103279
methyl 2-[(2-ethoxy-2-oxoethyl)-(4-nitrophenyl)sulfonylamino]-3-hydroxypropanoate (PubChem CID 21103279) has the molecular formula C14H18N2O9S and a molecular weight of 390.37 g/mol. Its IUPAC name is methyl 2-[(2-ethoxy-2-oxoethyl)-(4-nitrophenyl)sulfonylamino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(2-ethoxy-2-oxoethyl)-(4-nitrophenyl)sulfonylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 21103279 |
| Molecular Formula | C14H18N2O9S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | methyl 2-[(2-ethoxy-2-oxoethyl)-(4-nitrophenyl)sulfonylamino]-3-hydroxypropanoate |
| SMILES | CCOC(=O)CN(C(CO)C(=O)OC)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H18N2O9S/c1-3-25-13(18)8-15(12(9-17)14(19)24-2)26(22,23)11-6-4-10(5-7-11)16(20)21/h4-7,12,17H,3,8-9H2,1-2H3 |
| InChIKey | RGWGGYDTHPQJKE-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|