C16H21N3O8 — CID 70101184
methyl 2-[(2-ethoxy-2-oxoethyl)carbamoyl-[(3-nitrophenyl)methyl]amino]-3-hydroxypropanoate (PubChem CID 70101184) has the molecular formula C16H21N3O8 and a molecular weight of 383.36 g/mol. Its IUPAC name is methyl 2-[(2-ethoxy-2-oxoethyl)carbamoyl-[(3-nitrophenyl)methyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(2-ethoxy-2-oxoethyl)carbamoyl-[(3-nitrophenyl)methyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 70101184 |
| Molecular Formula | C16H21N3O8 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | methyl 2-[(2-ethoxy-2-oxoethyl)carbamoyl-[(3-nitrophenyl)methyl]amino]-3-hydroxypropanoate |
| SMILES | CCOC(=O)CNC(=O)N(Cc1cccc([N+](=O)[O-])c1)C(CO)C(=O)OC |
| InChI | InChI=1S/C16H21N3O8/c1-3-27-14(21)8-17-16(23)18(13(10-20)15(22)26-2)9-11-5-4-6-12(7-11)19(24)25/h4-7,13,20H,3,8-10H2,1-2H3,(H,17,23) |
| InChIKey | RWYQVZKHXFHRCA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|