C21H21N3O10 — CID 11712600
dimethyl (2S)-2-[(2,4-dinitrobenzoyl)-[(3-methoxyphenyl)methyl]amino]butanedioate (PubChem CID 11712600) has the molecular formula C21H21N3O10 and a molecular weight of 475.41 g/mol. Its IUPAC name is dimethyl (2S)-2-[(2,4-dinitrobenzoyl)-[(3-methoxyphenyl)methyl]amino]butanedioate.
| Compound Name | dimethyl (2S)-2-[(2,4-dinitrobenzoyl)-[(3-methoxyphenyl)methyl]amino]butanedioate |
|---|---|
| PubChem CID | 11712600 |
| Molecular Formula | C21H21N3O10 |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | dimethyl (2S)-2-[(2,4-dinitrobenzoyl)-[(3-methoxyphenyl)methyl]amino]butanedioate |
| SMILES | COC(=O)C[C@@H](C(=O)OC)N(Cc1cccc(OC)c1)C(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21N3O10/c1-32-15-6-4-5-13(9-15)12-22(18(21(27)34-3)11-19(25)33-2)20(26)16-8-7-14(23(28)29)10-17(16)24(30)31/h4-10,18H,11-12H2,1-3H3/t18-/m0/s1 |
| InChIKey | IKJOCFLEKFBMGS-SFHVURJKSA-N |
| XLogP | 2.26 |
| TPSA | 168.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|