C34H36N4O7S — CID 133200948
2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propylpropanamide (PubChem CID 133200948) has the molecular formula C34H36N4O7S and a molecular weight of 644.75 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propylpropanamide |
|---|---|
| PubChem CID | 133200948 |
| Molecular Formula | C34H36N4O7S |
| Molecular Weight | 644.75 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenyl-N-propylpropanamide |
| SMILES | CCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H36N4O7S/c1-3-20-35-34(40)32(22-26-12-6-4-7-13-26)36(24-27-14-10-17-30(21-27)45-2)33(39)25-37(28-15-11-16-29(23-28)38(41)42)46(43,44)31-18-8-5-9-19-31/h4-19,21,23,32H,3,20,22,24-25H2,1-2H3,(H,35,40) |
| InChIKey | SQMHCGALXLUHLB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.75 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|