C29H34N4O7S — CID 100605511
(2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-propylbutanamide (PubChem CID 100605511) has the molecular formula C29H34N4O7S and a molecular weight of 582.68 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-propylbutanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 100605511 |
| Molecular Formula | C29H34N4O7S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)[C@@H](CC)N(Cc1cccc(OC)c1)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H34N4O7S/c1-4-17-30-29(35)27(5-2)31(20-22-11-9-14-25(18-22)40-3)28(34)21-32(23-12-10-13-24(19-23)33(36)37)41(38,39)26-15-7-6-8-16-26/h6-16,18-19,27H,4-5,17,20-21H2,1-3H3,(H,30,35)/t27-/m1/s1 |
| InChIKey | INBMULNLKCBQCR-HHHXNRCGSA-N |
| XLogP | 4.13 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|