C24H31N3O5 — CID 100743726
(2S)-N-[(2S)-butan-2-yl]-2-[(3-methoxyphenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide (PubChem CID 100743726) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-[(3-methoxyphenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-[(3-methoxyphenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 100743726 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-[(3-methoxyphenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](CC)N(Cc1cccc(OC)c1)C(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H31N3O5/c1-5-17(3)25-24(29)21(6-2)26(16-18-10-9-12-20(14-18)32-4)23(28)15-19-11-7-8-13-22(19)27(30)31/h7-14,17,21H,5-6,15-16H2,1-4H3,(H,25,29)/t17-,21-/m0/s1 |
| InChIKey | HTKDZIRKRNLOHE-UWJYYQICSA-N |
| XLogP | 3.87 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|