C23H27Cl2N3O4 — CID 100736125
(2S)-N-[(2S)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide (PubChem CID 100736125) has the molecular formula C23H27Cl2N3O4 and a molecular weight of 480.39 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 100736125 |
| Molecular Formula | C23H27Cl2N3O4 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](CC)N(Cc1c(Cl)cccc1Cl)C(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H27Cl2N3O4/c1-4-15(3)26-23(30)20(5-2)27(14-17-18(24)10-8-11-19(17)25)22(29)13-16-9-6-7-12-21(16)28(31)32/h6-12,15,20H,4-5,13-14H2,1-3H3,(H,26,30)/t15-,20-/m0/s1 |
| InChIKey | LBGZDRSCKVKESQ-YWZLYKJASA-N |
| XLogP | 5.17 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|