C25H29Cl2N3O4 — CID 100582728
(2R)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide (PubChem CID 100582728) has the molecular formula C25H29Cl2N3O4 and a molecular weight of 506.43 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 100582728 |
| Molecular Formula | C25H29Cl2N3O4 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]butanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1c(Cl)cccc1Cl)C(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H29Cl2N3O4/c1-2-22(25(32)28-18-10-4-3-5-11-18)29(16-19-20(26)12-8-13-21(19)27)24(31)15-17-9-6-7-14-23(17)30(33)34/h6-9,12-14,18,22H,2-5,10-11,15-16H2,1H3,(H,28,32)/t22-/m1/s1 |
| InChIKey | LEZPYLOVYNWAAN-JOCHJYFZSA-N |
| XLogP | 5.70 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|