C30H33N3O4 — CID 100571867
(2R)-2-[benzyl-[2-(2-nitrophenyl)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 100571867) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is (2R)-2-[benzyl-[2-(2-nitrophenyl)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[benzyl-[2-(2-nitrophenyl)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100571867 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (2R)-2-[benzyl-[2-(2-nitrophenyl)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](Cc1ccccc1)N(Cc1ccccc1)C(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H33N3O4/c34-29(21-25-16-10-11-19-27(25)33(36)37)32(22-24-14-6-2-7-15-24)28(20-23-12-4-1-5-13-23)30(35)31-26-17-8-3-9-18-26/h1-2,4-7,10-16,19,26,28H,3,8-9,17-18,20-22H2,(H,31,35)/t28-/m1/s1 |
| InChIKey | XVMQBNSPFKFESW-MUUNZHRXSA-N |
| XLogP | 5.23 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|