C24H27Cl2N3O4 — CID 132618279
N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]propanamide (PubChem CID 132618279) has the molecular formula C24H27Cl2N3O4 and a molecular weight of 492.40 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]propanamide.
| Compound Name | N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132618279 |
| Molecular Formula | C24H27Cl2N3O4 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | N-cyclohexyl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]propanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N(Cc1c(Cl)cccc1Cl)C(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H27Cl2N3O4/c1-16(24(31)27-18-9-3-2-4-10-18)28(15-19-20(25)11-7-12-21(19)26)23(30)14-17-8-5-6-13-22(17)29(32)33/h5-8,11-13,16,18H,2-4,9-10,14-15H2,1H3,(H,27,31) |
| InChIKey | VPKATHOOARWANZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|