C28H29Cl2N3O4 — CID 133259990
N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-3-phenylpropanamide (PubChem CID 133259990) has the molecular formula C28H29Cl2N3O4 and a molecular weight of 542.46 g/mol. Its IUPAC name is N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133259990 |
| Molecular Formula | C28H29Cl2N3O4 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCC(C)NC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H29Cl2N3O4/c1-3-19(2)31-28(35)26(16-20-10-5-4-6-11-20)32(18-22-23(29)13-9-14-24(22)30)27(34)17-21-12-7-8-15-25(21)33(36)37/h4-15,19,26H,3,16-18H2,1-2H3,(H,31,35) |
| InChIKey | PFUKQJBHZUIHAV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|