C14H13N3O7 — CID 10568788
ethyl 2-[3-[(3-nitrophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate (PubChem CID 10568788) has the molecular formula C14H13N3O7 and a molecular weight of 335.27 g/mol. Its IUPAC name is ethyl 2-[3-[(3-nitrophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(3-nitrophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 10568788 |
| Molecular Formula | C14H13N3O7 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | ethyl 2-[3-[(3-nitrophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=O)N(Cc2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C14H13N3O7/c1-2-24-11(18)8-16-13(20)12(19)15(14(16)21)7-9-4-3-5-10(6-9)17(22)23/h3-6H,2,7-8H2,1H3 |
| InChIKey | OHHUJRWGANFPIH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|