C25H20N2O7S — CID 126050877
ethyl 2-[(5E)-5-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126050877) has the molecular formula C25H20N2O7S and a molecular weight of 492.51 g/mol. Its IUPAC name is ethyl 2-[(5E)-5-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(5E)-5-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126050877 |
| Molecular Formula | C25H20N2O7S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | ethyl 2-[(5E)-5-[[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)S/C(=C/c2c(OCc3cccc([N+](=O)[O-])c3)ccc3ccccc23)C1=O |
| InChI | InChI=1S/C25H20N2O7S/c1-2-33-23(28)14-26-24(29)22(35-25(26)30)13-20-19-9-4-3-7-17(19)10-11-21(20)34-15-16-6-5-8-18(12-16)27(31)32/h3-13H,2,14-15H2,1H3/b22-13+ |
| InChIKey | CGQSRBPVQJCNRD-LPYMAVHISA-N |
| XLogP | 4.93 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|