C27H25NO5S — CID 126209408
[(2R)-butan-2-yl] 2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 126209408) has the molecular formula C27H25NO5S and a molecular weight of 475.57 g/mol. Its IUPAC name is [(2R)-butan-2-yl] 2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2R)-butan-2-yl] 2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126209408 |
| Molecular Formula | C27H25NO5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | [(2R)-butan-2-yl] 2-[(5E)-2,4-dioxo-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC[C@@H](C)OC(=O)CN1C(=O)S/C(=C/c2c(OCc3ccccc3)ccc3ccccc23)C1=O |
| InChI | InChI=1S/C27H25NO5S/c1-3-18(2)33-25(29)16-28-26(30)24(34-27(28)31)15-22-21-12-8-7-11-20(21)13-14-23(22)32-17-19-9-5-4-6-10-19/h4-15,18H,3,16-17H2,1-2H3/b24-15+/t18-/m1/s1 |
| InChIKey | WMZRBVBVOKKQGS-LSPPGFKNSA-N |
| XLogP | 5.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|