C21H21NO5S — CID 126215460
[(2R)-butan-2-yl] 2-[(5E)-5-[(2-methoxynaphthalen-1-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126215460) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is [(2R)-butan-2-yl] 2-[(5E)-5-[(2-methoxynaphthalen-1-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2R)-butan-2-yl] 2-[(5E)-5-[(2-methoxynaphthalen-1-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126215460 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [(2R)-butan-2-yl] 2-[(5E)-5-[(2-methoxynaphthalen-1-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC[C@@H](C)OC(=O)CN1C(=O)S/C(=C/c2c(OC)ccc3ccccc23)C1=O |
| InChI | InChI=1S/C21H21NO5S/c1-4-13(2)27-19(23)12-22-20(24)18(28-21(22)25)11-16-15-8-6-5-7-14(15)9-10-17(16)26-3/h5-11,13H,4,12H2,1-3H3/b18-11+/t13-/m1/s1 |
| InChIKey | IIKXMIFYFUNCKI-VBEHJTROSA-N |
| XLogP | 4.23 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|