C12H8N4O9 — CID 10689308
2-[3-[(3,5-dinitrophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid (PubChem CID 10689308) has the molecular formula C12H8N4O9 and a molecular weight of 352.22 g/mol. Its IUPAC name is 2-[3-[(3,5-dinitrophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[3-[(3,5-dinitrophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10689308 |
| Molecular Formula | C12H8N4O9 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-[3-[(3,5-dinitrophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=O)N(Cc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C12H8N4O9/c17-9(18)5-14-11(20)10(19)13(12(14)21)4-6-1-7(15(22)23)3-8(2-6)16(24)25/h1-3H,4-5H2,(H,17,18) |
| InChIKey | DKFYTRXMSZDOPS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 181.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|