About 1-(iodomethyl)-3,5-dinitrobenzene
1-(iodomethyl)-3,5-dinitrobenzene (PubChem CID 22609073) has the molecular formula C7H5IN2O4
and a molecular weight of 308.03 g/mol. Its IUPAC name is 1-(iodomethyl)-3,5-dinitrobenzene.
Molecular Properties
| Compound Name | 1-(iodomethyl)-3,5-dinitrobenzene |
| PubChem CID | 22609073 |
| Molecular Formula | C7H5IN2O4 |
| Molecular Weight | 308.03 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | 1-(iodomethyl)-3,5-dinitrobenzene |
| SMILES | O=[N+]([O-])c1cc(CI)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5IN2O4/c8-4-5-1-6(9(11)12)3-7(2-5)10(13)14/h1-3H,4H2 |
| InChIKey | IMINZNDLTTVURA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.03 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(iodomethyl)-3,5-dinitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(iodomethyl)-3,5-dinitrobenzene?
The IUPAC name of 1-(iodomethyl)-3,5-dinitrobenzene (CID 22609073) is 1-(iodomethyl)-3,5-dinitrobenzene.
What is the SMILES notation for 1-(iodomethyl)-3,5-dinitrobenzene?
The canonical SMILES for 1-(iodomethyl)-3,5-dinitrobenzene is O=[N+]([O-])c1cc(CI)cc([N+](=O)[O-])c1.
What is the InChIKey of 1-(iodomethyl)-3,5-dinitrobenzene?
The InChIKey is IMINZNDLTTVURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IN2O4/c8-4-5-1-6(9(11)12)3-7(2-5)10(13)14/h1-3H,4H2.
What are the key properties of 1-(iodomethyl)-3,5-dinitrobenzene?
1-(iodomethyl)-3,5-dinitrobenzene has a molecular weight of 308.03 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(iodomethyl)-3,5-dinitrobenzene is sourced from PubChem (CID 22609073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).