C7H7N3O5 — CID 5191653
O-[(3,5-dinitrophenyl)methyl]hydroxylamine (PubChem CID 5191653) has the molecular formula C7H7N3O5 and a molecular weight of 213.15 g/mol. Its IUPAC name is O-[(3,5-dinitrophenyl)methyl]hydroxylamine.
| Compound Name | O-[(3,5-dinitrophenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 5191653 |
| Molecular Formula | C7H7N3O5 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | O-[(3,5-dinitrophenyl)methyl]hydroxylamine |
| SMILES | NOCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H7N3O5/c8-15-4-5-1-6(9(11)12)3-7(2-5)10(13)14/h1-3H,4,8H2 |
| InChIKey | XWTZKAKUNNFAHY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|