C14H16N2O8 — CID 170685917
[2-[(3,5-dinitrophenyl)methoxy]-2-oxoethyl] 2-methylbutanoate (PubChem CID 170685917) has the molecular formula C14H16N2O8 and a molecular weight of 340.29 g/mol. Its IUPAC name is [2-[(3,5-dinitrophenyl)methoxy]-2-oxoethyl] 2-methylbutanoate.
| Compound Name | [2-[(3,5-dinitrophenyl)methoxy]-2-oxoethyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 170685917 |
| Molecular Formula | C14H16N2O8 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [2-[(3,5-dinitrophenyl)methoxy]-2-oxoethyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC(=O)OCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N2O8/c1-3-9(2)14(18)24-8-13(17)23-7-10-4-11(15(19)20)6-12(5-10)16(21)22/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | XKAIWCQLWCEFPJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|