C17H15N3O8 — CID 102509784
(2R)-2-[(3,5-dinitrophenyl)methoxycarbonylamino]-3-phenylpropanoic acid (PubChem CID 102509784) has the molecular formula C17H15N3O8 and a molecular weight of 389.32 g/mol. Its IUPAC name is (2R)-2-[(3,5-dinitrophenyl)methoxycarbonylamino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[(3,5-dinitrophenyl)methoxycarbonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 102509784 |
| Molecular Formula | C17H15N3O8 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (2R)-2-[(3,5-dinitrophenyl)methoxycarbonylamino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)O)OCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15N3O8/c21-16(22)15(8-11-4-2-1-3-5-11)18-17(23)28-10-12-6-13(19(24)25)9-14(7-12)20(26)27/h1-7,9,15H,8,10H2,(H,18,23)(H,21,22)/t15-/m1/s1 |
| InChIKey | UAYGLHQRQABYSG-OAHLLOKOSA-N |
| XLogP | 2.43 |
| TPSA | 161.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|