C17H15FN2O6 — CID 103954495
3-(3-fluoro-5-nitrophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 103954495) has the molecular formula C17H15FN2O6 and a molecular weight of 362.31 g/mol. Its IUPAC name is 3-(3-fluoro-5-nitrophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(3-fluoro-5-nitrophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 103954495 |
| Molecular Formula | C17H15FN2O6 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 3-(3-fluoro-5-nitrophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1cc(F)cc([N+](=O)[O-])c1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C17H15FN2O6/c18-13-6-12(7-14(9-13)20(24)25)8-15(16(21)22)19-17(23)26-10-11-4-2-1-3-5-11/h1-7,9,15H,8,10H2,(H,19,23)(H,21,22) |
| InChIKey | PXUIJZHJVDSNHY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|