C19H19FN2O6S — CID 113358085
4-[(3-fluoro-5-nitrophenyl)methylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 113358085) has the molecular formula C19H19FN2O6S and a molecular weight of 422.43 g/mol. Its IUPAC name is 4-[(3-fluoro-5-nitrophenyl)methylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-[(3-fluoro-5-nitrophenyl)methylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 113358085 |
| Molecular Formula | C19H19FN2O6S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 4-[(3-fluoro-5-nitrophenyl)methylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(NC(CCSCc1cc(F)cc([N+](=O)[O-])c1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C19H19FN2O6S/c20-15-8-14(9-16(10-15)22(26)27)12-29-7-6-17(18(23)24)21-19(25)28-11-13-4-2-1-3-5-13/h1-5,8-10,17H,6-7,11-12H2,(H,21,25)(H,23,24) |
| InChIKey | KFCOMZLHWHCIBH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|