C30H31N3O10 — CID 70378280
3-[(4-nitrophenyl)methyl]-2,6-bis(phenylmethoxycarbonylamino)heptanedioic acid (PubChem CID 70378280) has the molecular formula C30H31N3O10 and a molecular weight of 593.59 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)methyl]-2,6-bis(phenylmethoxycarbonylamino)heptanedioic acid.
| Compound Name | 3-[(4-nitrophenyl)methyl]-2,6-bis(phenylmethoxycarbonylamino)heptanedioic acid |
|---|---|
| PubChem CID | 70378280 |
| Molecular Formula | C30H31N3O10 |
| Molecular Weight | 593.59 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | 3-[(4-nitrophenyl)methyl]-2,6-bis(phenylmethoxycarbonylamino)heptanedioic acid |
| SMILES | O=C(NC(CCC(Cc1ccc([N+](=O)[O-])cc1)C(NC(=O)OCc1ccccc1)C(=O)O)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C30H31N3O10/c34-27(35)25(31-29(38)42-18-21-7-3-1-4-8-21)16-13-23(17-20-11-14-24(15-12-20)33(40)41)26(28(36)37)32-30(39)43-19-22-9-5-2-6-10-22/h1-12,14-15,23,25-26H,13,16-19H2,(H,31,38)(H,32,39)(H,34,35)(H,36,37) |
| InChIKey | LFWQPCMTLMEWFD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 194.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|