C25H34N2O5 — CID 135004630
benzyl N-[(2R,3S)-1-ethoxy-3-[(4-nitrophenyl)methyl]-2-propylpentyl]carbamate (PubChem CID 135004630) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is benzyl N-[(2R,3S)-1-ethoxy-3-[(4-nitrophenyl)methyl]-2-propylpentyl]carbamate.
| Compound Name | benzyl N-[(2R,3S)-1-ethoxy-3-[(4-nitrophenyl)methyl]-2-propylpentyl]carbamate |
|---|---|
| PubChem CID | 135004630 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | benzyl N-[(2R,3S)-1-ethoxy-3-[(4-nitrophenyl)methyl]-2-propylpentyl]carbamate |
| SMILES | CCC[C@@H](C(NC(=O)OCc1ccccc1)OCC)[C@@H](CC)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H34N2O5/c1-4-10-23(21(5-2)17-19-13-15-22(16-14-19)27(29)30)24(31-6-3)26-25(28)32-18-20-11-8-7-9-12-20/h7-9,11-16,21,23-24H,4-6,10,17-18H2,1-3H3,(H,26,28)/t21-,23+,24?/m0/s1 |
| InChIKey | AFCXSPIXNMQSGX-AZIDCLHTSA-N |
| XLogP | 5.87 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|