C43H48N6O10 — CID 160907290
(2S)-2-amino-3-(4-nitrophenyl)propanoic acid;benzyl N-[(2R)-1-(4-aminophenyl)propan-2-yl]carbamate;benzyl N-[(2R)-1-(4-nitrophenyl)propan-2-yl]carbamate (PubChem CID 160907290) has the molecular formula C43H48N6O10 and a molecular weight of 808.89 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-nitrophenyl)propanoic acid;benzyl N-[(2R)-1-(4-aminophenyl)propan-2-yl]carbamate;benzyl N-[(2R)-1-(4-nitrophenyl)propan-2-yl]carbamate.
| Compound Name | (2S)-2-amino-3-(4-nitrophenyl)propanoic acid;benzyl N-[(2R)-1-(4-aminophenyl)propan-2-yl]carbamate;benzyl N-[(2R)-1-(4-nitrophenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 160907290 |
| Molecular Formula | C43H48N6O10 |
| Molecular Weight | 808.89 g/mol |
| Exact Mass | 808.34 |
| IUPAC Name | (2S)-2-amino-3-(4-nitrophenyl)propanoic acid;benzyl N-[(2R)-1-(4-aminophenyl)propan-2-yl]carbamate;benzyl N-[(2R)-1-(4-nitrophenyl)propan-2-yl]carbamate |
| SMILES | C[C@H](Cc1ccc(N)cc1)NC(=O)OCc1ccccc1.C[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)OCc1ccccc1.N[C@@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C17H18N2O4.C17H20N2O2.C9H10N2O4/c1-13(11-14-7-9-16(10-8-14)19(21)22)18-17(20)23-12-15-5-3-2-4-6-15;1-13(11-14-7-9-16(18)10-8-14)19-17(20)21-12-15-5-3-2-4-6-15;10-8(9(12)13)5-6-1-3-7(4-2-6)11(14)15/h2-10,13H,11-12H2,1H3,(H,18,20);2-10,13H,11-12,18H2,1H3,(H,19,20);1-4,8H,5,10H2,(H,12,13)/t2*13-;8-/m110/s1 |
| InChIKey | SQHQWVXMFPREST-LGEVXJBESA-N |
| XLogP | 7.13 |
| TPSA | 252.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.89 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|