C23H21N3O5 — CID 3104542
2,2-bis(4-nitrophenyl)-N-(1-phenylpropan-2-yl)acetamide (PubChem CID 3104542) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2,2-bis(4-nitrophenyl)-N-(1-phenylpropan-2-yl)acetamide.
| Compound Name | 2,2-bis(4-nitrophenyl)-N-(1-phenylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 3104542 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2,2-bis(4-nitrophenyl)-N-(1-phenylpropan-2-yl)acetamide |
| SMILES | CC(Cc1ccccc1)NC(=O)C(c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H21N3O5/c1-16(15-17-5-3-2-4-6-17)24-23(27)22(18-7-11-20(12-8-18)25(28)29)19-9-13-21(14-10-19)26(30)31/h2-14,16,22H,15H2,1H3,(H,24,27) |
| InChIKey | SKSBIDXFNLSUDP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|