C24H30N4O6 — CID 175714509
benzyl 2-[[(2S)-2-[[(2S)-2-amino-3-(4-nitrophenyl)propanoyl]amino]-3,3-dimethylbutanoyl]amino]acetate (PubChem CID 175714509) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is benzyl 2-[[(2S)-2-[[(2S)-2-amino-3-(4-nitrophenyl)propanoyl]amino]-3,3-dimethylbutanoyl]amino]acetate.
| Compound Name | benzyl 2-[[(2S)-2-[[(2S)-2-amino-3-(4-nitrophenyl)propanoyl]amino]-3,3-dimethylbutanoyl]amino]acetate |
|---|---|
| PubChem CID | 175714509 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | benzyl 2-[[(2S)-2-[[(2S)-2-amino-3-(4-nitrophenyl)propanoyl]amino]-3,3-dimethylbutanoyl]amino]acetate |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@@H](N)Cc1ccc([N+](=O)[O-])cc1)C(=O)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H30N4O6/c1-24(2,3)21(23(31)26-14-20(29)34-15-17-7-5-4-6-8-17)27-22(30)19(25)13-16-9-11-18(12-10-16)28(32)33/h4-12,19,21H,13-15,25H2,1-3H3,(H,26,31)(H,27,30)/t19-,21+/m0/s1 |
| InChIKey | JYXLSRGGEPHPKT-PZJWPPBQSA-N |
| XLogP | 1.86 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|