C18H20N2O5 — CID 54038783
benzyl 2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]acetate (PubChem CID 54038783) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is benzyl 2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]acetate.
| Compound Name | benzyl 2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 54038783 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | benzyl 2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]acetate |
| SMILES | N[C@@H](Cc1ccc(O)c(O)c1)C(=O)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H20N2O5/c19-14(8-13-6-7-15(21)16(22)9-13)18(24)20-10-17(23)25-11-12-4-2-1-3-5-12/h1-7,9,14,21-22H,8,10-11,19H2,(H,20,24)/t14-/m0/s1 |
| InChIKey | LKVSYVCWDJWLIS-AWEZNQCLSA-N |
| XLogP | 0.83 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|