C19H22N2O3S — CID 14216015
benzyl 2-[[(2R)-2-amino-3-benzylsulfanylpropanoyl]amino]acetate (PubChem CID 14216015) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is benzyl 2-[[(2R)-2-amino-3-benzylsulfanylpropanoyl]amino]acetate.
| Compound Name | benzyl 2-[[(2R)-2-amino-3-benzylsulfanylpropanoyl]amino]acetate |
|---|---|
| PubChem CID | 14216015 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | benzyl 2-[[(2R)-2-amino-3-benzylsulfanylpropanoyl]amino]acetate |
| SMILES | N[C@@H](CSCc1ccccc1)C(=O)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O3S/c20-17(14-25-13-16-9-5-2-6-10-16)19(23)21-11-18(22)24-12-15-7-3-1-4-8-15/h1-10,17H,11-14,20H2,(H,21,23)/t17-/m0/s1 |
| InChIKey | WAIHGXBDAYEBLY-KRWDZBQOSA-N |
| XLogP | 2.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |