C19H21NO3S — CID 56608471
benzyl 2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]acetate (PubChem CID 56608471) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is benzyl 2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]acetate.
| Compound Name | benzyl 2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]acetate |
|---|---|
| PubChem CID | 56608471 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | benzyl 2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]acetate |
| SMILES | O=C(CNC(=O)[C@H](CS)Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C19H21NO3S/c21-18(23-13-16-9-5-2-6-10-16)12-20-19(22)17(14-24)11-15-7-3-1-4-8-15/h1-10,17,24H,11-14H2,(H,20,22)/t17-/m0/s1 |
| InChIKey | LFABBWTUJCBFQG-KRWDZBQOSA-N |
| XLogP | 2.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|