C21H20N2O3S2 — CID 142273740
[3-(1,3-thiazol-2-yl)phenyl] 2-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]acetate (PubChem CID 142273740) has the molecular formula C21H20N2O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is [3-(1,3-thiazol-2-yl)phenyl] 2-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]acetate.
| Compound Name | [3-(1,3-thiazol-2-yl)phenyl] 2-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]acetate |
|---|---|
| PubChem CID | 142273740 |
| Molecular Formula | C21H20N2O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [3-(1,3-thiazol-2-yl)phenyl] 2-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]acetate |
| SMILES | O=C(CNC(=O)[C@@H](CS)Cc1ccccc1)Oc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C21H20N2O3S2/c24-19(26-18-8-4-7-16(12-18)21-22-9-10-28-21)13-23-20(25)17(14-27)11-15-5-2-1-3-6-15/h1-10,12,17,27H,11,13-14H2,(H,23,25)/t17-/m1/s1 |
| InChIKey | OYYGGXBUWUZFSQ-QGZVFWFLSA-N |
| XLogP | 3.62 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|