C29H27N3O4S2 — CID 54562179
methyl (2S)-2-[[2-(benzoylsulfanylmethyl)-3-pyridin-3-ylpropanoyl]amino]-3-[4-(1,3-thiazol-2-yl)phenyl]propanoate (PubChem CID 54562179) has the molecular formula C29H27N3O4S2 and a molecular weight of 545.69 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(benzoylsulfanylmethyl)-3-pyridin-3-ylpropanoyl]amino]-3-[4-(1,3-thiazol-2-yl)phenyl]propanoate.
| Compound Name | methyl (2S)-2-[[2-(benzoylsulfanylmethyl)-3-pyridin-3-ylpropanoyl]amino]-3-[4-(1,3-thiazol-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 54562179 |
| Molecular Formula | C29H27N3O4S2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | methyl (2S)-2-[[2-(benzoylsulfanylmethyl)-3-pyridin-3-ylpropanoyl]amino]-3-[4-(1,3-thiazol-2-yl)phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(-c2nccs2)cc1)NC(=O)C(CSC(=O)c1ccccc1)Cc1cccnc1 |
| InChI | InChI=1S/C29H27N3O4S2/c1-36-28(34)25(17-20-9-11-22(12-10-20)27-31-14-15-37-27)32-26(33)24(16-21-6-5-13-30-18-21)19-38-29(35)23-7-3-2-4-8-23/h2-15,18,24-25H,16-17,19H2,1H3,(H,32,33)/t24?,25-/m0/s1 |
| InChIKey | ZRIMQZXATCDHTO-BBMPLOMVSA-N |
| XLogP | 4.84 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|