C31H29N3O4S — CID 19604201
methyl 2-[[2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(4-pyrazin-2-ylphenyl)propanoate (PubChem CID 19604201) has the molecular formula C31H29N3O4S and a molecular weight of 539.66 g/mol. Its IUPAC name is methyl 2-[[2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(4-pyrazin-2-ylphenyl)propanoate.
| Compound Name | methyl 2-[[2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(4-pyrazin-2-ylphenyl)propanoate |
|---|---|
| PubChem CID | 19604201 |
| Molecular Formula | C31H29N3O4S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | methyl 2-[[2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(4-pyrazin-2-ylphenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(-c2cnccn2)cc1)NC(=O)C(CSC(=O)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H29N3O4S/c1-38-30(36)27(19-23-12-14-24(15-13-23)28-20-32-16-17-33-28)34-29(35)26(18-22-8-4-2-5-9-22)21-39-31(37)25-10-6-3-7-11-25/h2-17,20,26-27H,18-19,21H2,1H3,(H,34,35) |
| InChIKey | QAMUEFSUKWRPDN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|