C30H27NO5S — CID 139824278
(2S)-2-[[(2S)-2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-[4-(furan-3-yl)phenyl]propanoic acid (PubChem CID 139824278) has the molecular formula C30H27NO5S and a molecular weight of 513.62 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-[4-(furan-3-yl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-[4-(furan-3-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 139824278 |
| Molecular Formula | C30H27NO5S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-[4-(furan-3-yl)phenyl]propanoic acid |
| SMILES | O=C(SC[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(-c2ccoc2)cc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C30H27NO5S/c32-28(31-27(29(33)34)18-22-11-13-23(14-12-22)25-15-16-36-19-25)26(17-21-7-3-1-4-8-21)20-37-30(35)24-9-5-2-6-10-24/h1-16,19,26-27H,17-18,20H2,(H,31,32)(H,33,34)/t26-,27+/m1/s1 |
| InChIKey | MDIISSOZRXEFIG-SXOMAYOGSA-N |
| XLogP | 5.49 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|