C23H23NO4S — CID 19604140
2-[(2-benzyl-3-sulfanylpropanoyl)amino]-3-[4-(furan-3-yl)phenyl]propanoic acid (PubChem CID 19604140) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-[(2-benzyl-3-sulfanylpropanoyl)amino]-3-[4-(furan-3-yl)phenyl]propanoic acid.
| Compound Name | 2-[(2-benzyl-3-sulfanylpropanoyl)amino]-3-[4-(furan-3-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 19604140 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-[(2-benzyl-3-sulfanylpropanoyl)amino]-3-[4-(furan-3-yl)phenyl]propanoic acid |
| SMILES | O=C(NC(Cc1ccc(-c2ccoc2)cc1)C(=O)O)C(CS)Cc1ccccc1 |
| InChI | InChI=1S/C23H23NO4S/c25-22(20(15-29)12-16-4-2-1-3-5-16)24-21(23(26)27)13-17-6-8-18(9-7-17)19-10-11-28-14-19/h1-11,14,20-21,29H,12-13,15H2,(H,24,25)(H,26,27) |
| InChIKey | YOMFQSGFIDPSCR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|