C21H25NO4S2 — CID 10364791
(2R)-2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]-3-[(4-methoxyphenyl)methylsulfanyl]propanoic acid (PubChem CID 10364791) has the molecular formula C21H25NO4S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]-3-[(4-methoxyphenyl)methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]-3-[(4-methoxyphenyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 10364791 |
| Molecular Formula | C21H25NO4S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (2R)-2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]-3-[(4-methoxyphenyl)methylsulfanyl]propanoic acid |
| SMILES | COc1ccc(CSC[C@H](NC(=O)[C@H](CS)Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C21H25NO4S2/c1-26-18-9-7-16(8-10-18)13-28-14-19(21(24)25)22-20(23)17(12-27)11-15-5-3-2-4-6-15/h2-10,17,19,27H,11-14H2,1H3,(H,22,23)(H,24,25)/t17-,19-/m0/s1 |
| InChIKey | USBOCZIRMRDNKY-HKUYNNGSSA-N |
| XLogP | 3.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|