C14H17NO5S — CID 88519240
(2S)-2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]butanedioic acid (PubChem CID 88519240) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 88519240 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (2S)-2-[[(2R)-2-benzyl-3-sulfanylpropanoyl]amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)[C@H](CS)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H17NO5S/c16-12(17)7-11(14(19)20)15-13(18)10(8-21)6-9-4-2-1-3-5-9/h1-5,10-11,21H,6-8H2,(H,15,18)(H,16,17)(H,19,20)/t10-,11-/m0/s1 |
| InChIKey | CDEWSNIFQPDLLX-QWRGUYRKSA-N |
| XLogP | 0.82 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|