C20H20N2O3S2 — CID 139677512
(2S)-3-(1,3-benzothiazol-2-yl)-2-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 139677512) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is (2S)-3-(1,3-benzothiazol-2-yl)-2-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-(1,3-benzothiazol-2-yl)-2-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 139677512 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (2S)-3-(1,3-benzothiazol-2-yl)-2-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1nc2ccccc2s1)C(=O)O)[C@@H](CS)Cc1ccccc1 |
| InChI | InChI=1S/C20H20N2O3S2/c23-19(14(12-26)10-13-6-2-1-3-7-13)22-16(20(24)25)11-18-21-15-8-4-5-9-17(15)27-18/h1-9,14,16,26H,10-12H2,(H,22,23)(H,24,25)/t14-,16+/m1/s1 |
| InChIKey | QPIHJVWVOAQBNH-ZBFHGGJFSA-N |
| XLogP | 3.20 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|