C29H27NO3S — CID 54263811
(2S)-2-[(2-benzyl-3-sulfanylpropanoyl)amino]-3-(4-naphthalen-1-ylphenyl)propanoic acid (PubChem CID 54263811) has the molecular formula C29H27NO3S and a molecular weight of 469.61 g/mol. Its IUPAC name is (2S)-2-[(2-benzyl-3-sulfanylpropanoyl)amino]-3-(4-naphthalen-1-ylphenyl)propanoic acid.
| Compound Name | (2S)-2-[(2-benzyl-3-sulfanylpropanoyl)amino]-3-(4-naphthalen-1-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 54263811 |
| Molecular Formula | C29H27NO3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (2S)-2-[(2-benzyl-3-sulfanylpropanoyl)amino]-3-(4-naphthalen-1-ylphenyl)propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(-c2cccc3ccccc23)cc1)C(=O)O)C(CS)Cc1ccccc1 |
| InChI | InChI=1S/C29H27NO3S/c31-28(24(19-34)17-20-7-2-1-3-8-20)30-27(29(32)33)18-21-13-15-23(16-14-21)26-12-6-10-22-9-4-5-11-25(22)26/h1-16,24,27,34H,17-19H2,(H,30,31)(H,32,33)/t24?,27-/m0/s1 |
| InChIKey | RFJAKAUXJGMXMB-WKDCXCOVSA-N |
| XLogP | 5.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|