C13H14F3NO3S — CID 54566496
(2S)-3-phenyl-2-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]propanoic acid (PubChem CID 54566496) has the molecular formula C13H14F3NO3S and a molecular weight of 321.32 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54566496 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (2S)-3-phenyl-2-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)O)C(CS)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO3S/c14-13(15,16)9(7-21)11(18)17-10(12(19)20)6-8-4-2-1-3-5-8/h1-5,9-10,21H,6-7H2,(H,17,18)(H,19,20)/t9?,10-/m0/s1 |
| InChIKey | ZUENRZREMWSTQD-AXDSSHIGSA-N |
| XLogP | 1.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|