C14H16F3N3O3S — CID 10428779
(2S)-3-phenyl-2-[[(2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]propanamide (PubChem CID 10428779) has the molecular formula C14H16F3N3O3S and a molecular weight of 363.36 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[[(2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]propanamide.
| Compound Name | (2S)-3-phenyl-2-[[(2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]propanamide |
|---|---|
| PubChem CID | 10428779 |
| Molecular Formula | C14H16F3N3O3S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | (2S)-3-phenyl-2-[[(2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]propanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CS)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O3S/c15-14(16,17)13(23)20-10(7-24)12(22)19-9(11(18)21)6-8-4-2-1-3-5-8/h1-5,9-10,24H,6-7H2,(H2,18,21)(H,19,22)(H,20,23)/t9-,10-/m0/s1 |
| InChIKey | NWSWANFQYXALDR-UWVGGRQHSA-N |
| XLogP | 0.18 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|