C27H27N3O3S — CID 55936649
benzyl N-[(2S)-1-[3-(1,3-benzothiazol-2-yl)propylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 55936649) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[3-(1,3-benzothiazol-2-yl)propylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[3-(1,3-benzothiazol-2-yl)propylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 55936649 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | benzyl N-[(2S)-1-[3-(1,3-benzothiazol-2-yl)propylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)NCCCc1nc2ccccc2s1)OCc1ccccc1 |
| InChI | InChI=1S/C27H27N3O3S/c31-26(28-17-9-16-25-29-22-14-7-8-15-24(22)34-25)23(18-20-10-3-1-4-11-20)30-27(32)33-19-21-12-5-2-6-13-21/h1-8,10-15,23H,9,16-19H2,(H,28,31)(H,30,32)/t23-/m0/s1 |
| InChIKey | KBJQHJZGCBVABH-QHCPKHFHSA-N |
| XLogP | 4.88 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|