C38H42N2O4S — CID 67894607
(2R)-3-benzylsulfanyl-2-[[2,4-dibenzyl-5-oxo-5-(3-phenylpropylamino)pentanoyl]amino]propanoic acid (PubChem CID 67894607) has the molecular formula C38H42N2O4S and a molecular weight of 622.83 g/mol. Its IUPAC name is (2R)-3-benzylsulfanyl-2-[[2,4-dibenzyl-5-oxo-5-(3-phenylpropylamino)pentanoyl]amino]propanoic acid.
| Compound Name | (2R)-3-benzylsulfanyl-2-[[2,4-dibenzyl-5-oxo-5-(3-phenylpropylamino)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67894607 |
| Molecular Formula | C38H42N2O4S |
| Molecular Weight | 622.83 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | (2R)-3-benzylsulfanyl-2-[[2,4-dibenzyl-5-oxo-5-(3-phenylpropylamino)pentanoyl]amino]propanoic acid |
| SMILES | O=C(NCCCc1ccccc1)C(Cc1ccccc1)CC(Cc1ccccc1)C(=O)N[C@@H](CSCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C38H42N2O4S/c41-36(39-23-13-22-29-14-5-1-6-15-29)33(24-30-16-7-2-8-17-30)26-34(25-31-18-9-3-10-19-31)37(42)40-35(38(43)44)28-45-27-32-20-11-4-12-21-32/h1-12,14-21,33-35H,13,22-28H2,(H,39,41)(H,40,42)(H,43,44)/t33?,34?,35-/m0/s1 |
| InChIKey | IPLZVAAYPXYDPY-YLNHBKTGSA-N |
| XLogP | 6.35 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.83 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|